@import url('https://fonts.googleapis.com/css2?family=DM+Sans:wght@400;500;600;700&family=Source+Sans+3:wght@400;500;600;700&display=swap');

/* PoolDial Brand Guidelines v2: marketing identity, adapted for an interactive tool. */
:root {
  --color-pool-900: #0c3a74;
  --color-pool-700: #15599f;
  --color-pool-500: #016ec3;
  --color-pool-100: #d6e9ff;
  --color-coral-500: #f58654;
  --color-aqua-500: #00bfa6;
  --color-ink: #2c2a29;
  --color-slate-700: #334155;
  --color-slate-500: #64748b;
  --color-slate-300: #cbd5e1;
  --color-slate-100: #f1f5f9;
  --color-cloud: #e8f1f8;
  --color-white: #fff;
  --font-display: 'DM Sans', sans-serif;
  --font-body: 'Source Sans 3', sans-serif;
  font-family: var(--font-body);
  color: var(--color-ink);
  background: var(--color-white);
  font-synthesis: none;
}
* { box-sizing: border-box; }
body { margin: 0; }
button, input { font: inherit; }
button, a { touch-action: manipulation; }
button { cursor: pointer; }
button, a, input { -webkit-tap-highlight-color: transparent; }
button:focus-visible, a:focus-visible, input:focus-visible {
  outline: 3px solid var(--color-pool-700);
  outline-offset: 3px;
}
a { color: var(--color-pool-700); text-underline-offset: 3px; }
button:disabled { opacity: .4; cursor: default; }
.quiz {
  height: 100dvh;
  min-height: 520px;
  display: grid;
  grid-template-columns: minmax(0, 1fr) minmax(420px, 1fr);
  grid-template-rows: 76px minmax(0, 1fr);
}
header {
  grid-column: 1 / -1;
  display: flex;
  align-items: center;
  justify-content: space-between;
  padding: 0 4%;
  border-bottom: 1px solid var(--color-slate-300);
  background: var(--color-white);
}
.brand { display: flex; align-items: center; gap: 24px; text-decoration: none; }
.brand img { width: 148px; height: auto; display: block; }
.brand span { border-left: 1px solid var(--color-slate-300); padding-left: 24px; font-size: 16px; color: var(--color-slate-700); }
.guide { font-size: 15px; font-weight: 600; min-height: 44px; display: flex; align-items: center; }
.scene {
  background: var(--color-cloud);
  display: flex;
  flex-direction: column;
  align-items: center;
  min-height: 0;
  padding: 32px 28px 20px;
  border-right: 1px solid var(--color-slate-300);
}
.scene-heading { text-align: center; }
.eyebrow { font-size: 14px; font-weight: 600; color: var(--color-pool-700); }
h1, h2 { font-family: var(--font-display); font-weight: 700; color: var(--color-pool-900); letter-spacing: -.6px; line-height: 1.2; }
h1 { font-size: clamp(28px, 3.2vw, 44px); margin: 10px 0; }
.scene-heading p { font-size: 17px; line-height: 1.5; margin: 0; color: var(--color-slate-700); }
.truck { flex: 1; min-height: 0; width: 100%; display: flex; align-items: center; justify-content: center; }
.truck svg { width: 100%; height: 100%; max-height: 580px; }
.scene-caption { width: min(100%, 430px); display: flex; justify-content: space-between; gap: 12px; align-items: center; font-size: 14px; }
#count { color: var(--color-pool-900); font-weight: 700; }
.scene-caption span:last-child { color: var(--color-slate-700); }
.visual-note { max-width: 430px; font-size: 12px; line-height: 1.5; color: var(--color-slate-700); margin: 10px 0 0; }
.panel { display: flex; flex-direction: column; padding: 28px clamp(24px, 3vw, 48px) 16px; min-width: 0; min-height: 0; background: var(--color-white); }
.progress { display: flex; gap: 8px; margin-bottom: 24px; flex-shrink: 0; }
.progress span { height: 5px; background: var(--color-slate-100); flex: 1; border-radius: 3px; }
.progress .done { background: var(--color-pool-500); }
.panel-body { flex: 1; min-height: 0; overflow-y: auto; scrollbar-gutter: stable; padding: 4px 10px 4px 4px; margin: -4px; overscroll-behavior: contain; }
h2 { font-size: clamp(25px, 2.4vw, 34px); margin: 10px 0; }
p.intro { color: var(--color-slate-700); font-size: 17px; line-height: 1.5; margin: 0 0 20px; }
.choices { display: grid; grid-template-columns: 1fr 1fr; gap: 10px; }
.choice { min-height: 72px; text-align: left; background: var(--color-white); border: 1px solid var(--color-slate-300); border-radius: 8px; padding: 12px; display: flex; align-items: center; gap: 10px; color: var(--color-ink); }
.choice:hover { border-color: var(--color-pool-500); background: var(--color-cloud); }
.choice[aria-pressed=true] { border-color: var(--color-pool-500); background: var(--color-pool-100); box-shadow: inset 0 0 0 1px var(--color-pool-500); }
.choice svg { width: 30px; height: 36px; flex-shrink: 0; }
.choice span { flex: 1; font-size: 16px; font-weight: 600; line-height: 1.3; }
.choice b { font-size: 19px; color: var(--color-pool-700); }
.custom { margin: 0 0 16px; }
.custom summary { cursor: pointer; color: var(--color-pool-700); font-weight: 600; min-height: 44px; padding: 10px 0; }
.custom summary:focus-visible { outline: 3px solid var(--color-pool-700); outline-offset: 2px; }
.custom form { padding: 8px 0; }
.custom label { display: block; font-size: 16px; font-weight: 600; margin-bottom: 8px; }
.custom-row { display: flex; gap: 8px; }
.custom input { min-width: 0; flex: 1; padding: 11px 12px; border: 1px solid var(--color-slate-300); border-radius: 8px; background: var(--color-white); color: var(--color-ink); font-size: 16px; }
.custom-row button { min-height: 44px; padding: 10px 18px; border-radius: 8px; border: 1px solid var(--color-pool-700); background: var(--color-white); color: var(--color-pool-700); font-weight: 600; }
.custom-list { margin: 8px 0 0; padding: 0; list-style: none; }
.custom-list:empty { display: none; }
.custom-list li { display: flex; align-items: center; justify-content: space-between; gap: 8px; padding-left: 12px; background: var(--color-cloud); border-radius: 8px; margin-top: 6px; overflow-wrap: anywhere; }
.custom-list button { flex-shrink: 0; min-width: 44px; min-height: 44px; border: 0; background: transparent; color: var(--color-pool-700); font-size: 23px; }
footer { display: flex; gap: 10px; padding-top: 16px; margin-top: 12px; border-top: 1px solid var(--color-slate-300); flex-shrink: 0; }
footer button { min-height: 50px; border-radius: 8px; border: 0; font-family: var(--font-display); font-weight: 600; padding: 12px 18px; font-size: 15px; }
.primary { background: var(--color-coral-500); color: var(--color-ink); flex: 1; }
.primary:hover { background: #ff9c82; }
.secondary { background: var(--color-slate-100); color: var(--color-slate-700); }
.status { font-size: 14px; line-height: 1.4; margin: 8px 0 0; max-height: 60px; overflow-y: auto; overflow-wrap: anywhere; }
.status:empty { display: none; }
.summary { font-size: 17px; line-height: 1.6; padding-left: 20px; overflow-wrap: anywhere; }
.summary li { margin-bottom: 16px; }
.summary strong { display: block; color: var(--color-pool-700); font-family: var(--font-display); font-size: 16px; }
.share { font-weight: 600; color: var(--color-pool-700); min-height: 48px; }
p.source { margin-top: 20px; font-size: 15px; }
.empty-label { fill: var(--color-slate-700); }
.item { animation: pack .2s ease-out; }
@keyframes pack { from { opacity: .6; } to { opacity: 1; } }
@media (min-width: 1600px) { .panel { padding-right: max(48px, calc((100vw - 1500px)/2)); } }
@media (max-width: 760px) {
  .quiz { display: flex; flex-direction: column; min-height: 0; overflow: hidden; }
  header { padding: 8px 20px; min-height: 58px; flex-shrink: 0; }
  .brand img { width: 125px; }
  .brand span { display: none; }
  .guide { font-size: 14px; }
  .scene { padding: 12px 20px; flex-shrink: 0; border-right: 0; border-bottom: 1px solid var(--color-slate-300); }
  .scene-heading .eyebrow, .scene-heading p { display: none; }
  .scene-heading h1 { font-size: 26px; margin: 0 0 6px; }
  .truck { flex: none; height: clamp(130px, 24svh, 235px); }
  .truck svg { max-height: 100%; }
  .scene-caption { font-size: 13px; max-width: 360px; }
  .visual-note { font-size: 11px; max-width: 360px; margin-top: 6px; line-height: 1.3; }
  .panel { padding: 16px 20px max(12px, env(safe-area-inset-bottom)); flex: 1; }
  .progress { margin-bottom: 14px; }
  h2 { font-size: 25px; margin: 7px 0; }
  p.intro { font-size: 16px; margin-bottom: 16px; }
  .eyebrow { font-size: 13px; }
  .choice { min-height: 66px; padding: 9px; gap: 7px; }
  .choice svg { width: 25px; height: 30px; }
  .choice span { font-size: 16px; }
  footer { margin-top: 10px; padding-top: 12px; }
  footer button { font-size: 14px; padding: 10px 14px; }
}
@media (max-width: 370px) {
  header, .panel, .scene { padding-left: 14px; padding-right: 14px; }
  .scene-heading h1 { font-size: 23px; }
  .choices { grid-template-columns: 1fr; }
  .scene-caption span:last-child { display: none; }
}
@media (max-height: 600px) and (max-width: 760px) {
  .truck { height: 110px; }
  .scene-heading h1 { font-size: 21px; }
  .visual-note { font-size: 10px; }
}
@media (prefers-reduced-motion: reduce) { .item { animation: none; } }

.email-gate > label { display: block; font-weight: 600; font-size: 17px; margin-bottom: 8px; }
.email-gate > input { width: 100%; padding: 13px; border: 1px solid var(--color-slate-300); border-radius: 8px; font-size: 17px; }
.email-gate p.intro { font-size: 14px; margin-top: 16px; }

.more-items { margin: 14px 0 4px; }
.more-items summary { min-height:44px; padding:12px 0; cursor:pointer; color:var(--color-pool-700); font-weight:600; }
.more-items summary:focus-visible { outline:3px solid var(--color-pool-700); outline-offset:2px; }
.quantities { display:grid; grid-template-columns:1fr 1fr; gap:12px; margin-top:14px; }
.quantities:empty { display:none; }
.quantities label { font-weight:600; font-size:15px; }
.quantities label span { display:block; font-weight:400; font-size:13px; color:var(--color-slate-700); }
.quantities input { width:100%; padding:10px; border:1px solid var(--color-slate-300); border-radius:8px; font-size:16px; margin-top:6px; }
.route-form label { display:block; margin:24px 0 8px; font-size:17px; font-weight:600; }
.route-form select,.route-form input { width:100%; min-height:48px; padding:12px; border:1px solid var(--color-slate-300); border-radius:8px; font:inherit; font-size:17px; background:#fff; color:var(--color-ink); }